C7H12O6 — CID 118285722
(3R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-one (PubChem CID 118285722) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (3R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-one.
| Compound Name | (3R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-one |
|---|---|
| PubChem CID | 118285722 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (3R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-one |
| SMILES | COC1OC(CO)[C@@H](O)C(=O)C1O |
| InChI | InChI=1S/C7H12O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-4,6-9,11H,2H2,1H3/t3?,4-,6?,7?/m1/s1 |
| InChIKey | XXYFBPWHGAWSET-VCHPSSMLSA-N |
| XLogP | -2.36 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |