C12H14O6 — CID 118285747
(3R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenoxyoxan-4-one (PubChem CID 118285747) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is (3R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenoxyoxan-4-one.
| Compound Name | (3R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenoxyoxan-4-one |
|---|---|
| PubChem CID | 118285747 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (3R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-phenoxyoxan-4-one |
| SMILES | O=C1C(O)[C@@H](Oc2ccccc2)OC(CO)[C@H]1O |
| InChI | InChI=1S/C12H14O6/c13-6-8-9(14)10(15)11(16)12(18-8)17-7-4-2-1-3-5-7/h1-5,8-9,11-14,16H,6H2/t8?,9-,11?,12+/m1/s1 |
| InChIKey | TVFJSDPITJRLCK-SUMRLAOFSA-N |
| XLogP | -0.93 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |