C25H17ClN2O3 — CID 118285941
methyl 4-[1-(2-chloro-6-methylbenzoyl)-6-ethynylindazol-3-yl]benzoate (PubChem CID 118285941) has the molecular formula C25H17ClN2O3 and a molecular weight of 428.88 g/mol. Its IUPAC name is methyl 4-[1-(2-chloro-6-methylbenzoyl)-6-ethynylindazol-3-yl]benzoate.
| Compound Name | methyl 4-[1-(2-chloro-6-methylbenzoyl)-6-ethynylindazol-3-yl]benzoate |
|---|---|
| PubChem CID | 118285941 |
| Molecular Formula | C25H17ClN2O3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | methyl 4-[1-(2-chloro-6-methylbenzoyl)-6-ethynylindazol-3-yl]benzoate |
| SMILES | C#Cc1ccc2c(-c3ccc(C(=O)OC)cc3)nn(C(=O)c3c(C)cccc3Cl)c2c1 |
| InChI | InChI=1S/C25H17ClN2O3/c1-4-16-8-13-19-21(14-16)28(24(29)22-15(2)6-5-7-20(22)26)27-23(19)17-9-11-18(12-10-17)25(30)31-3/h1,5-14H,2-3H3 |
| InChIKey | LKPSCNDDQADVQY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|