C16H12ClIN4O2 — CID 118285958
1-(2-chloro-6-methylbenzoyl)-3-iodoindazole-6-carbohydrazide (PubChem CID 118285958) has the molecular formula C16H12ClIN4O2 and a molecular weight of 454.66 g/mol. Its IUPAC name is 1-(2-chloro-6-methylbenzoyl)-3-iodoindazole-6-carbohydrazide.
| Compound Name | 1-(2-chloro-6-methylbenzoyl)-3-iodoindazole-6-carbohydrazide |
|---|---|
| PubChem CID | 118285958 |
| Molecular Formula | C16H12ClIN4O2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 1-(2-chloro-6-methylbenzoyl)-3-iodoindazole-6-carbohydrazide |
| SMILES | Cc1cccc(Cl)c1C(=O)n1nc(I)c2ccc(C(=O)NN)cc21 |
| InChI | InChI=1S/C16H12ClIN4O2/c1-8-3-2-4-11(17)13(8)16(24)22-12-7-9(15(23)20-19)5-6-10(12)14(18)21-22/h2-7H,19H2,1H3,(H,20,23) |
| InChIKey | RNVKZWCBOQBCIM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|