C21H19ClN2O3 — CID 123804956
methyl 1-(2-chloro-6-cyclopropylbenzoyl)-3-ethylindazole-6-carboxylate (PubChem CID 123804956) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is methyl 1-(2-chloro-6-cyclopropylbenzoyl)-3-ethylindazole-6-carboxylate.
| Compound Name | methyl 1-(2-chloro-6-cyclopropylbenzoyl)-3-ethylindazole-6-carboxylate |
|---|---|
| PubChem CID | 123804956 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | methyl 1-(2-chloro-6-cyclopropylbenzoyl)-3-ethylindazole-6-carboxylate |
| SMILES | CCc1nn(C(=O)c2c(Cl)cccc2C2CC2)c2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C21H19ClN2O3/c1-3-17-15-10-9-13(21(26)27-2)11-18(15)24(23-17)20(25)19-14(12-7-8-12)5-4-6-16(19)22/h4-6,9-12H,3,7-8H2,1-2H3 |
| InChIKey | IKCMXQOSLAKARH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |