C19H18ClIN2O3 — CID 122492615
methyl (6S)-1-(2-chloro-6-cyclopropylbenzoyl)-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate (PubChem CID 122492615) has the molecular formula C19H18ClIN2O3 and a molecular weight of 484.72 g/mol. Its IUPAC name is methyl (6S)-1-(2-chloro-6-cyclopropylbenzoyl)-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate.
| Compound Name | methyl (6S)-1-(2-chloro-6-cyclopropylbenzoyl)-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate |
|---|---|
| PubChem CID | 122492615 |
| Molecular Formula | C19H18ClIN2O3 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | methyl (6S)-1-(2-chloro-6-cyclopropylbenzoyl)-3-iodo-4,5,6,7-tetrahydroindazole-6-carboxylate |
| SMILES | COC(=O)[C@H]1CCc2c(I)nn(C(=O)c3c(Cl)cccc3C3CC3)c2C1 |
| InChI | InChI=1S/C19H18ClIN2O3/c1-26-19(25)11-7-8-13-15(9-11)23(22-17(13)21)18(24)16-12(10-5-6-10)3-2-4-14(16)20/h2-4,10-11H,5-9H2,1H3/t11-/m0/s1 |
| InChIKey | IUAVAKAEXAAZAL-NSHDSACASA-N |
| XLogP | 3.98 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|