C16H14ClIN2O2 — CID 129091761
(2-chloro-6-cyclopropylphenyl)-(3-iodo-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-1-yl)methanone (PubChem CID 129091761) has the molecular formula C16H14ClIN2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is (2-chloro-6-cyclopropylphenyl)-(3-iodo-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-1-yl)methanone.
| Compound Name | (2-chloro-6-cyclopropylphenyl)-(3-iodo-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-1-yl)methanone |
|---|---|
| PubChem CID | 129091761 |
| Molecular Formula | C16H14ClIN2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | (2-chloro-6-cyclopropylphenyl)-(3-iodo-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-1-yl)methanone |
| SMILES | O=C(c1c(Cl)cccc1C1CC1)n1nc(I)c2c1COCC2 |
| InChI | InChI=1S/C16H14ClIN2O2/c17-12-3-1-2-10(9-4-5-9)14(12)16(21)20-13-8-22-7-6-11(13)15(18)19-20/h1-3,9H,4-8H2 |
| InChIKey | XGCJVJBUAHAYGE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|