C17H10F3IN2O3 — CID 148605963
3-iodo-1-[2-methyl-6-(trifluoromethyl)benzoyl]indazole-6-carboxylic acid (PubChem CID 148605963) has the molecular formula C17H10F3IN2O3 and a molecular weight of 474.18 g/mol. Its IUPAC name is 3-iodo-1-[2-methyl-6-(trifluoromethyl)benzoyl]indazole-6-carboxylic acid.
| Compound Name | 3-iodo-1-[2-methyl-6-(trifluoromethyl)benzoyl]indazole-6-carboxylic acid |
|---|---|
| PubChem CID | 148605963 |
| Molecular Formula | C17H10F3IN2O3 |
| Molecular Weight | 474.18 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 3-iodo-1-[2-methyl-6-(trifluoromethyl)benzoyl]indazole-6-carboxylic acid |
| SMILES | Cc1cccc(C(F)(F)F)c1C(=O)n1nc(I)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C17H10F3IN2O3/c1-8-3-2-4-11(17(18,19)20)13(8)15(24)23-12-7-9(16(25)26)5-6-10(12)14(21)22-23/h2-7H,1H3,(H,25,26) |
| InChIKey | NDKHRCWKWQPNLL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|