About 9-acetylcarbazole-3,6-dicarbohydrazide
9-acetylcarbazole-3,6-dicarbohydrazide (PubChem CID 174724830) has the molecular formula C16H15N5O3
and a molecular weight of 325.33 g/mol. Its IUPAC name is 9-acetylcarbazole-3,6-dicarbohydrazide.
Molecular Properties
| Compound Name | 9-acetylcarbazole-3,6-dicarbohydrazide |
| PubChem CID | 174724830 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 9-acetylcarbazole-3,6-dicarbohydrazide |
| SMILES | CC(=O)n1c2ccc(C(=O)NN)cc2c2cc(C(=O)NN)ccc21 |
| InChI | InChI=1S/C16H15N5O3/c1-8(22)21-13-4-2-9(15(23)19-17)6-11(13)12-7-10(16(24)20-18)3-5-14(12)21/h2-7H,17-18H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | VLFNSNBUJIHDED-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-acetylcarbazole-3,6-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-acetylcarbazole-3,6-dicarbohydrazide?
The IUPAC name of 9-acetylcarbazole-3,6-dicarbohydrazide (CID 174724830) is 9-acetylcarbazole-3,6-dicarbohydrazide.
What is the SMILES notation for 9-acetylcarbazole-3,6-dicarbohydrazide?
The canonical SMILES for 9-acetylcarbazole-3,6-dicarbohydrazide is CC(=O)n1c2ccc(C(=O)NN)cc2c2cc(C(=O)NN)ccc21.
What is the InChIKey of 9-acetylcarbazole-3,6-dicarbohydrazide?
The InChIKey is VLFNSNBUJIHDED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O3/c1-8(22)21-13-4-2-9(15(23)19-17)6-11(13)12-7-10(16(24)20-18)3-5-14(12)21/h2-7H,17-18H2,1H3,(H,19,23)(H,20,24).
What are the key properties of 9-acetylcarbazole-3,6-dicarbohydrazide?
9-acetylcarbazole-3,6-dicarbohydrazide has a molecular weight of 325.33 g/mol, XLogP of 0.66, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-acetylcarbazole-3,6-dicarbohydrazide is sourced from PubChem (CID 174724830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).