C15H20N2O6 — CID 118287001
(2,5-dioxopyrrolidin-1-yl) 6-[[(Z)-but-2-enoyl]-formylamino]hexanoate (PubChem CID 118287001) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[(Z)-but-2-enoyl]-formylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[(Z)-but-2-enoyl]-formylamino]hexanoate |
|---|---|
| PubChem CID | 118287001 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[(Z)-but-2-enoyl]-formylamino]hexanoate |
| SMILES | C/C=C\C(=O)N(C=O)CCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H20N2O6/c1-2-6-12(19)16(11-18)10-5-3-4-7-15(22)23-17-13(20)8-9-14(17)21/h2,6,11H,3-5,7-10H2,1H3/b6-2- |
| InChIKey | ZEOLGQVGIAYZMC-KXFIGUGUSA-N |
| XLogP | 0.72 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|