C20H20ClNO2S — CID 118290650
(1Z)-1-[4-(2-chloro-5-methylphenyl)-3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene]propan-2-one (PubChem CID 118290650) has the molecular formula C20H20ClNO2S and a molecular weight of 373.91 g/mol. Its IUPAC name is (1Z)-1-[4-(2-chloro-5-methylphenyl)-3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene]propan-2-one.
| Compound Name | (1Z)-1-[4-(2-chloro-5-methylphenyl)-3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene]propan-2-one |
|---|---|
| PubChem CID | 118290650 |
| Molecular Formula | C20H20ClNO2S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (1Z)-1-[4-(2-chloro-5-methylphenyl)-3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene]propan-2-one |
| SMILES | CCN1/C(=C/C(C)=O)Sc2ccc(OC)c(-c3cc(C)ccc3Cl)c21 |
| InChI | InChI=1S/C20H20ClNO2S/c1-5-22-18(11-13(3)23)25-17-9-8-16(24-4)19(20(17)22)14-10-12(2)6-7-15(14)21/h6-11H,5H2,1-4H3/b18-11- |
| InChIKey | JZWXMMPTIJLGRP-WQRHYEAKSA-N |
| XLogP | 5.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|