C12H17BrN2O2 — CID 118292120
[1-[4-(bromomethyl)-2-pyridinyl]-2,2-dimethylpropyl]carbamic acid (PubChem CID 118292120) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is [1-[4-(bromomethyl)-2-pyridinyl]-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [1-[4-(bromomethyl)-2-pyridinyl]-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 118292120 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | [1-[4-(bromomethyl)-2-pyridinyl]-2,2-dimethylpropyl]carbamic acid |
| SMILES | CC(C)(C)C(NC(=O)O)c1cc(CBr)ccn1 |
| InChI | InChI=1S/C12H17BrN2O2/c1-12(2,3)10(15-11(16)17)9-6-8(7-13)4-5-14-9/h4-6,10,15H,7H2,1-3H3,(H,16,17) |
| InChIKey | ONJYIIHEMITBED-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|