C25H22ClF3N4O6 — CID 118293269
4-[4-[[[2-(2-acetamidoethoxy)-4-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid (PubChem CID 118293269) has the molecular formula C25H22ClF3N4O6 and a molecular weight of 566.92 g/mol. Its IUPAC name is 4-[4-[[[2-(2-acetamidoethoxy)-4-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid.
| Compound Name | 4-[4-[[[2-(2-acetamidoethoxy)-4-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118293269 |
| Molecular Formula | C25H22ClF3N4O6 |
| Molecular Weight | 566.92 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | 4-[4-[[[2-(2-acetamidoethoxy)-4-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid |
| SMILES | CC(=O)NCCOc1cc(Cl)c(C(F)(F)F)cc1NC(=O)NCc1ccc(Oc2ccnc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H22ClF3N4O6/c1-14(34)30-8-9-38-22-12-19(26)18(25(27,28)29)11-20(22)33-24(37)32-13-15-2-4-16(5-3-15)39-17-6-7-31-21(10-17)23(35)36/h2-7,10-12H,8-9,13H2,1H3,(H,30,34)(H,35,36)(H2,32,33,37) |
| InChIKey | ZQJYIVYOKCXGPK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|