C22H21N3O5 — CID 90044907
4-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid (PubChem CID 90044907) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid.
| Compound Name | 4-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 90044907 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-[4-[[(2-methoxy-5-methylphenyl)carbamoylamino]methyl]phenoxy]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(C)cc1NC(=O)NCc1ccc(Oc2ccnc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H21N3O5/c1-14-3-8-20(29-2)18(11-14)25-22(28)24-13-15-4-6-16(7-5-15)30-17-9-10-23-19(12-17)21(26)27/h3-12H,13H2,1-2H3,(H,26,27)(H2,24,25,28) |
| InChIKey | WSQUCLVNVXNZBO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |