C12H22F2N2O — CID 118295186
2-(4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl)propan-2-ol (PubChem CID 118295186) has the molecular formula C12H22F2N2O and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-(4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl)propan-2-ol.
| Compound Name | 2-(4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 118295186 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2-(4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl)propan-2-ol |
| SMILES | CC(C)(O)C1CC(F)(F)CN1C1CCNCC1 |
| InChI | InChI=1S/C12H22F2N2O/c1-11(2,17)10-7-12(13,14)8-16(10)9-3-5-15-6-4-9/h9-10,15,17H,3-8H2,1-2H3 |
| InChIKey | IKGCGGJGBXNQBD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |