About 1-bromoethane-1,2-diol
1-bromoethane-1,2-diol (PubChem CID 11829546) has the molecular formula C2H5BrO2
and a molecular weight of 140.96 g/mol. Its IUPAC name is 1-bromoethane-1,2-diol.
Molecular Properties
| Compound Name | 1-bromoethane-1,2-diol |
| PubChem CID | 11829546 |
| Molecular Formula | C2H5BrO2 |
| Molecular Weight | 140.96 g/mol |
| Exact Mass | 139.95 |
| IUPAC Name | 1-bromoethane-1,2-diol |
| SMILES | OCC(O)Br |
| InChI | InChI=1S/C2H5BrO2/c3-2(5)1-4/h2,4-5H,1H2 |
| InChIKey | NZADTCVJTWKIBS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.96 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethane-1,2-diol?
The IUPAC name of 1-bromoethane-1,2-diol (CID 11829546) is 1-bromoethane-1,2-diol.
What is the SMILES notation for 1-bromoethane-1,2-diol?
The canonical SMILES for 1-bromoethane-1,2-diol is OCC(O)Br.
What is the InChIKey of 1-bromoethane-1,2-diol?
The InChIKey is NZADTCVJTWKIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5BrO2/c3-2(5)1-4/h2,4-5H,1H2.
What are the key properties of 1-bromoethane-1,2-diol?
1-bromoethane-1,2-diol has a molecular weight of 140.96 g/mol, XLogP of -0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethane-1,2-diol is sourced from PubChem (CID 11829546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).