C28H33Cl2N5O7 — CID 118295792
6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethylamino]-8-[2-(1-prop-2-enoylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 118295792) has the molecular formula C28H33Cl2N5O7 and a molecular weight of 622.51 g/mol. Its IUPAC name is 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethylamino]-8-[2-(1-prop-2-enoylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethylamino]-8-[2-(1-prop-2-enoylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 118295792 |
| Molecular Formula | C28H33Cl2N5O7 |
| Molecular Weight | 622.51 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethylamino]-8-[2-(1-prop-2-enoylazetidin-3-yl)oxyethyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CC(OCCn2c(=O)c(-c3c(Cl)c(OC)cc(OC)c3Cl)cc3cnc(NCCOCCOC)nc32)C1 |
| InChI | InChI=1S/C28H33Cl2N5O7/c1-5-22(36)34-15-18(16-34)42-9-7-35-26-17(14-32-28(33-26)31-6-8-41-11-10-38-2)12-19(27(35)37)23-24(29)20(39-3)13-21(40-4)25(23)30/h5,12-14,18H,1,6-11,15-16H2,2-4H3,(H,31,32,33) |
| InChIKey | YLTJSGXRTAOUCA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|