C9H8F2N4O — CID 118295998
2-(2,2-difluoroethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 118295998) has the molecular formula C9H8F2N4O and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(2,2-difluoroethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 118295998 |
| Molecular Formula | C9H8F2N4O |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(NCC(F)F)nc2[nH]1 |
| InChI | InChI=1S/C9H8F2N4O/c10-6(11)4-13-9-12-3-5-1-2-7(16)14-8(5)15-9/h1-3,6H,4H2,(H2,12,13,14,15,16) |
| InChIKey | JCKYEVBQBCJPNB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |