C23H22N2O4 — CID 118296421
N-[3-(3,4-dihydroxyphenyl)-1-(2-methylanilino)-1-oxopropan-2-yl]benzamide (PubChem CID 118296421) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[3-(3,4-dihydroxyphenyl)-1-(2-methylanilino)-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[3-(3,4-dihydroxyphenyl)-1-(2-methylanilino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 118296421 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[3-(3,4-dihydroxyphenyl)-1-(2-methylanilino)-1-oxopropan-2-yl]benzamide |
| SMILES | Cc1ccccc1NC(=O)C(Cc1ccc(O)c(O)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O4/c1-15-7-5-6-10-18(15)24-23(29)19(13-16-11-12-20(26)21(27)14-16)25-22(28)17-8-3-2-4-9-17/h2-12,14,19,26-27H,13H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | XLQAJEJXURGIBD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|