C13H14N2O8 — CID 118297332
2-nitro-5-[(4R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile (PubChem CID 118297332) has the molecular formula C13H14N2O8 and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-nitro-5-[(4R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile.
| Compound Name | 2-nitro-5-[(4R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 118297332 |
| Molecular Formula | C13H14N2O8 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-nitro-5-[(4R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzonitrile |
| SMILES | N#Cc1cc(OC2OC(CO)C(O)[C@@H](O)C2O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N2O8/c14-4-6-3-7(1-2-8(6)15(20)21)22-13-12(19)11(18)10(17)9(5-16)23-13/h1-3,9-13,16-19H,5H2/t9?,10?,11-,12?,13?/m1/s1 |
| InChIKey | AFAMKVXDUIBSDO-ZLXUSHJUSA-N |
| XLogP | -1.35 |
| TPSA | 166.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|