C20H20N2O9 — CID 130455379
2-[5-methyl-2-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]benzonitrile (PubChem CID 130455379) has the molecular formula C20H20N2O9 and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-[5-methyl-2-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]benzonitrile.
| Compound Name | 2-[5-methyl-2-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]benzonitrile |
|---|---|
| PubChem CID | 130455379 |
| Molecular Formula | C20H20N2O9 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[5-methyl-2-nitro-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]benzonitrile |
| SMILES | Cc1cc(Oc2ccccc2C#N)c([N+](=O)[O-])cc1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20N2O9/c1-10-6-15(29-13-5-3-2-4-11(13)8-21)12(22(27)28)7-14(10)30-20-19(26)18(25)17(24)16(9-23)31-20/h2-7,16-20,23-26H,9H2,1H3/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | BAGVLHOGIGVWNO-SLHNCBLASA-N |
| XLogP | 0.75 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|