C22H22N2O9 — CID 130469565
2-(hydroxymethyl)-6-(4-isoquinolin-7-yloxy-2-methyl-5-nitrophenoxy)oxane-3,4,5-triol (PubChem CID 130469565) has the molecular formula C22H22N2O9 and a molecular weight of 458.42 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(4-isoquinolin-7-yloxy-2-methyl-5-nitrophenoxy)oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(4-isoquinolin-7-yloxy-2-methyl-5-nitrophenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 130469565 |
| Molecular Formula | C22H22N2O9 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-(hydroxymethyl)-6-(4-isoquinolin-7-yloxy-2-methyl-5-nitrophenoxy)oxane-3,4,5-triol |
| SMILES | Cc1cc(Oc2ccc3ccncc3c2)c([N+](=O)[O-])cc1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C22H22N2O9/c1-11-6-17(31-14-3-2-12-4-5-23-9-13(12)7-14)15(24(29)30)8-16(11)32-22-21(28)20(27)19(26)18(10-25)33-22/h2-9,18-22,25-28H,10H2,1H3 |
| InChIKey | HYFAFWNEPWXODM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 164.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|