C24H21F2NO2 — CID 118298662
benzyl N-[(1R,2S)-1-(2,5-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 118298662) has the molecular formula C24H21F2NO2 and a molecular weight of 393.43 g/mol. Its IUPAC name is benzyl N-[(1R,2S)-1-(2,5-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | benzyl N-[(1R,2S)-1-(2,5-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 118298662 |
| Molecular Formula | C24H21F2NO2 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | benzyl N-[(1R,2S)-1-(2,5-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | O=C(N[C@H]1CCc2ccccc2[C@@H]1c1cc(F)ccc1F)OCc1ccccc1 |
| InChI | InChI=1S/C24H21F2NO2/c25-18-11-12-21(26)20(14-18)23-19-9-5-4-8-17(19)10-13-22(23)27-24(28)29-15-16-6-2-1-3-7-16/h1-9,11-12,14,22-23H,10,13,15H2,(H,27,28)/t22-,23+/m0/s1 |
| InChIKey | BSEDOOBJIQBFRI-XZOQPEGZSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |