C45H28N4S2 — CID 118299232
5-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)thieno[2,3-b]thiophen-2-yl]-3,9-diphenylcarbazole (PubChem CID 118299232) has the molecular formula C45H28N4S2 and a molecular weight of 688.88 g/mol. Its IUPAC name is 5-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)thieno[2,3-b]thiophen-2-yl]-3,9-diphenylcarbazole.
| Compound Name | 5-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)thieno[2,3-b]thiophen-2-yl]-3,9-diphenylcarbazole |
|---|---|
| PubChem CID | 118299232 |
| Molecular Formula | C45H28N4S2 |
| Molecular Weight | 688.88 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | 5-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)thieno[2,3-b]thiophen-2-yl]-3,9-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2c(-c4cc5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)sc5s4)cccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H28N4S2/c1-5-14-29(15-6-1)32-24-25-37-36(26-32)41-35(22-13-23-38(41)49(37)34-20-11-4-12-21-34)39-27-33-28-40(51-45(33)50-39)44-47-42(30-16-7-2-8-17-30)46-43(48-44)31-18-9-3-10-19-31/h1-28H |
| InChIKey | BUIMWDCBAFNXSV-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.88 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |