C25H25F3N5O6P — CID 118300015
[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-2-(difluoromethyl)-3-fluoro-4-hydroxyoxolan-2-yl]methyl bis(4-methylphenyl) phosphate (PubChem CID 118300015) has the molecular formula C25H25F3N5O6P and a molecular weight of 579.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-2-(difluoromethyl)-3-fluoro-4-hydroxyoxolan-2-yl]methyl bis(4-methylphenyl) phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-2-(difluoromethyl)-3-fluoro-4-hydroxyoxolan-2-yl]methyl bis(4-methylphenyl) phosphate |
|---|---|
| PubChem CID | 118300015 |
| Molecular Formula | C25H25F3N5O6P |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-2-(difluoromethyl)-3-fluoro-4-hydroxyoxolan-2-yl]methyl bis(4-methylphenyl) phosphate |
| SMILES | Cc1ccc(OP(=O)(OC[C@@]2(C(F)F)O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@H]2F)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25F3N5O6P/c1-14-3-7-16(8-4-14)38-40(35,39-17-9-5-15(2)6-10-17)36-11-25(24(27)28)20(26)19(34)23(37-25)33-13-32-18-21(29)30-12-31-22(18)33/h3-10,12-13,19-20,23-24,34H,11H2,1-2H3,(H2,29,30,31)/t19-,20-,23-,25-/m1/s1 |
| InChIKey | PFKRNPRTRCXWOM-LTWPEAGASA-N |
| XLogP | 4.54 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|