C25H26F2N5O6PS — CID 118299934
(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-[bis(4-methylphenoxy)phosphinothioyloxymethyl]-2-(difluoromethyl)oxolane-3,4-diol (PubChem CID 118299934) has the molecular formula C25H26F2N5O6PS and a molecular weight of 593.55 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-[bis(4-methylphenoxy)phosphinothioyloxymethyl]-2-(difluoromethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-[bis(4-methylphenoxy)phosphinothioyloxymethyl]-2-(difluoromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 118299934 |
| Molecular Formula | C25H26F2N5O6PS |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-[bis(4-methylphenoxy)phosphinothioyloxymethyl]-2-(difluoromethyl)oxolane-3,4-diol |
| SMILES | Cc1ccc(OP(=S)(OC[C@@]2(C(F)F)O[C@@H](n3cnc4c(N)ncnc43)[C@@H](O)[C@@H]2O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H26F2N5O6PS/c1-14-3-7-16(8-4-14)37-39(40,38-17-9-5-15(2)6-10-17)35-11-25(24(26)27)20(34)19(33)23(36-25)32-13-31-18-21(28)29-12-30-22(18)32/h3-10,12-13,19-20,23-24,33-34H,11H2,1-2H3,(H2,28,29,30)/t19-,20-,23+,25+/m0/s1 |
| InChIKey | CVQDQUKKASUINI-VRKOAZSQSA-N |
| XLogP | 3.68 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|