C19H27NO3 — CID 118301888
methyl (3S)-3-cyclopropyl-3-[3-(piperidin-3-ylmethoxy)phenyl]propanoate (PubChem CID 118301888) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is methyl (3S)-3-cyclopropyl-3-[3-(piperidin-3-ylmethoxy)phenyl]propanoate.
| Compound Name | methyl (3S)-3-cyclopropyl-3-[3-(piperidin-3-ylmethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 118301888 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | methyl (3S)-3-cyclopropyl-3-[3-(piperidin-3-ylmethoxy)phenyl]propanoate |
| SMILES | COC(=O)C[C@H](c1cccc(OCC2CCCNC2)c1)C1CC1 |
| InChI | InChI=1S/C19H27NO3/c1-22-19(21)11-18(15-7-8-15)16-5-2-6-17(10-16)23-13-14-4-3-9-20-12-14/h2,5-6,10,14-15,18,20H,3-4,7-9,11-13H2,1H3/t14?,18-/m0/s1 |
| InChIKey | IELIIANHCJFLCZ-IBYPIGCZSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |