C18H25NO3 — CID 123379917
methyl 3-[3-[2-(azetidin-3-yl)ethoxy]phenyl]-3-cyclopropylpropanoate (PubChem CID 123379917) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is methyl 3-[3-[2-(azetidin-3-yl)ethoxy]phenyl]-3-cyclopropylpropanoate.
| Compound Name | methyl 3-[3-[2-(azetidin-3-yl)ethoxy]phenyl]-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 123379917 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | methyl 3-[3-[2-(azetidin-3-yl)ethoxy]phenyl]-3-cyclopropylpropanoate |
| SMILES | COC(=O)CC(c1cccc(OCCC2CNC2)c1)C1CC1 |
| InChI | InChI=1S/C18H25NO3/c1-21-18(20)10-17(14-5-6-14)15-3-2-4-16(9-15)22-8-7-13-11-19-12-13/h2-4,9,13-14,17,19H,5-8,10-12H2,1H3 |
| InChIKey | OZTFPHKYFQYIDB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |