C25H26N4O3S — CID 118304197
3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]-N-(4-pyrimidin-2-ylphenyl)benzamide (PubChem CID 118304197) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]-N-(4-pyrimidin-2-ylphenyl)benzamide.
| Compound Name | 3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]-N-(4-pyrimidin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 118304197 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 3-[2-[(1,1-dioxothian-4-yl)amino]cyclopropyl]-N-(4-pyrimidin-2-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(-c2ncccn2)cc1)c1cccc(C2CC2NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C25H26N4O3S/c30-25(29-20-7-5-17(6-8-20)24-26-11-2-12-27-24)19-4-1-3-18(15-19)22-16-23(22)28-21-9-13-33(31,32)14-10-21/h1-8,11-12,15,21-23,28H,9-10,13-14,16H2,(H,29,30) |
| InChIKey | DDUYQAMEWAQHNX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |