C22H26N4O6S — CID 118304676
(E)-but-2-enedioic acid;N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[(1S,2R)-2-(oxan-4-ylamino)cyclopropyl]benzamide (PubChem CID 118304676) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[(1S,2R)-2-(oxan-4-ylamino)cyclopropyl]benzamide.
| Compound Name | (E)-but-2-enedioic acid;N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[(1S,2R)-2-(oxan-4-ylamino)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 118304676 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (E)-but-2-enedioic acid;N-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[(1S,2R)-2-(oxan-4-ylamino)cyclopropyl]benzamide |
| SMILES | Cc1nnc(NC(=O)c2cccc([C@@H]3C[C@H]3NC3CCOCC3)c2)s1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H22N4O2S.C4H4O4/c1-11-21-22-18(25-11)20-17(23)13-4-2-3-12(9-13)15-10-16(15)19-14-5-7-24-8-6-14;5-3(6)1-2-4(7)8/h2-4,9,14-16,19H,5-8,10H2,1H3,(H,20,22,23);1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,16+;/m0./s1 |
| InChIKey | RZNJNNWDCUZTSZ-KAPCYLQESA-N |
| XLogP | 2.44 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|