C15H20N4O5S3 — CID 118433215
4-[(1S,2R)-2-(cyclobutylamino)cyclopropyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide;sulfuric acid (PubChem CID 118433215) has the molecular formula C15H20N4O5S3 and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-[(1S,2R)-2-(cyclobutylamino)cyclopropyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide;sulfuric acid.
| Compound Name | 4-[(1S,2R)-2-(cyclobutylamino)cyclopropyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 118433215 |
| Molecular Formula | C15H20N4O5S3 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 4-[(1S,2R)-2-(cyclobutylamino)cyclopropyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide;sulfuric acid |
| SMILES | Cc1nnc(NC(=O)c2cc([C@@H]3C[C@H]3NC3CCC3)cs2)s1.O=S(=O)(O)O |
| InChI | InChI=1S/C15H18N4OS2.H2O4S/c1-8-18-19-15(22-8)17-14(20)13-5-9(7-21-13)11-6-12(11)16-10-3-2-4-10;1-5(2,3)4/h5,7,10-12,16H,2-4,6H2,1H3,(H,17,19,20);(H2,1,2,3,4)/t11-,12+;/m0./s1 |
| InChIKey | GVNZUJGCBDVTMF-ZVWHLABXSA-N |
| XLogP | 2.51 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|