C25H22ClN3O — CID 118305141
N-benzyl-4-[2-[(2-chloro-5-cyanophenyl)methylamino]cyclopropyl]benzamide (PubChem CID 118305141) has the molecular formula C25H22ClN3O and a molecular weight of 415.92 g/mol. Its IUPAC name is N-benzyl-4-[2-[(2-chloro-5-cyanophenyl)methylamino]cyclopropyl]benzamide.
| Compound Name | N-benzyl-4-[2-[(2-chloro-5-cyanophenyl)methylamino]cyclopropyl]benzamide |
|---|---|
| PubChem CID | 118305141 |
| Molecular Formula | C25H22ClN3O |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-benzyl-4-[2-[(2-chloro-5-cyanophenyl)methylamino]cyclopropyl]benzamide |
| SMILES | N#Cc1ccc(Cl)c(CNC2CC2c2ccc(C(=O)NCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H22ClN3O/c26-23-11-6-18(14-27)12-21(23)16-28-24-13-22(24)19-7-9-20(10-8-19)25(30)29-15-17-4-2-1-3-5-17/h1-12,22,24,28H,13,15-16H2,(H,29,30) |
| InChIKey | LAUMTKMTYINMRC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |