C14H23N3O — CID 118305615
methane;4-(6-methylpyrazin-2-yl)oxy-1-azabicyclo[3.3.1]nonane (PubChem CID 118305615) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is methane;4-(6-methylpyrazin-2-yl)oxy-1-azabicyclo[3.3.1]nonane.
| Compound Name | methane;4-(6-methylpyrazin-2-yl)oxy-1-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 118305615 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | methane;4-(6-methylpyrazin-2-yl)oxy-1-azabicyclo[3.3.1]nonane |
| SMILES | C.Cc1cncc(OC2CCN3CCCC2C3)n1 |
| InChI | InChI=1S/C13H19N3O.CH4/c1-10-7-14-8-13(15-10)17-12-4-6-16-5-2-3-11(12)9-16;/h7-8,11-12H,2-6,9H2,1H3;1H4 |
| InChIKey | LNLCZQDOIZPCAH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |