C11H15N3 — CID 71458009
(3R)-3-(6-methylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane (PubChem CID 71458009) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is (3R)-3-(6-methylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane.
| Compound Name | (3R)-3-(6-methylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 71458009 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (3R)-3-(6-methylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane |
| SMILES | Cc1cncc([C@H]2CN3CCC2C3)n1 |
| InChI | InChI=1S/C11H15N3/c1-8-4-12-5-11(13-8)10-7-14-3-2-9(10)6-14/h4-5,9-10H,2-3,6-7H2,1H3/t9?,10-/m0/s1 |
| InChIKey | RADOYUDOTJZTNO-AXDSSHIGSA-N |
| XLogP | 1.20 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |