C14H16F3N3O4 — CID 18658625
oxalic acid;(3R)-3-[6-(trifluoromethyl)pyrazin-2-yl]-1-azabicyclo[2.2.2]octane (PubChem CID 18658625) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is oxalic acid;(3R)-3-[6-(trifluoromethyl)pyrazin-2-yl]-1-azabicyclo[2.2.2]octane.
| Compound Name | oxalic acid;(3R)-3-[6-(trifluoromethyl)pyrazin-2-yl]-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 18658625 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | oxalic acid;(3R)-3-[6-(trifluoromethyl)pyrazin-2-yl]-1-azabicyclo[2.2.2]octane |
| SMILES | FC(F)(F)c1cncc([C@H]2CN3CCC2CC3)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H14F3N3.C2H2O4/c13-12(14,15)11-6-16-5-10(17-11)9-7-18-3-1-8(9)2-4-18;3-1(4)2(5)6/h5-6,8-9H,1-4,7H2;(H,3,4)(H,5,6)/t9-;/m0./s1 |
| InChIKey | ABDXDMMNUZDEFP-FVGYRXGTSA-N |
| XLogP | 1.46 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|