C14H15ClF3N3O — CID 22243249
N-(1-azabicyclo[2.2.2]octan-3-yl)-6-chloro-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 22243249) has the molecular formula C14H15ClF3N3O and a molecular weight of 333.74 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-6-chloro-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-6-chloro-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22243249 |
| Molecular Formula | C14H15ClF3N3O |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-6-chloro-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C14H15ClF3N3O/c15-12-9(14(16,17)18)1-2-10(19-12)13(22)20-11-7-21-5-3-8(11)4-6-21/h1-2,8,11H,3-7H2,(H,20,22) |
| InChIKey | IUWOPGXFHRUSRC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|