C15H22N4O — CID 62167266
N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(ethylamino)pyridine-2-carboxamide (PubChem CID 62167266) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(ethylamino)pyridine-2-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(ethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62167266 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(ethylamino)pyridine-2-carboxamide |
| SMILES | CCNc1ccnc(C(=O)NC2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C15H22N4O/c1-2-16-12-3-6-17-13(9-12)15(20)18-14-10-19-7-4-11(14)5-8-19/h3,6,9,11,14H,2,4-5,7-8,10H2,1H3,(H,16,17)(H,18,20) |
| InChIKey | WZLZDELUZVJBTG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |