C13H21N5O — CID 83025254
4-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 83025254) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | 4-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 83025254 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-(ethylamino)-N-(4-methylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | CCNc1ccnc(C(=O)NN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C13H21N5O/c1-3-14-11-4-5-15-12(10-11)13(19)16-18-8-6-17(2)7-9-18/h4-5,10H,3,6-9H2,1-2H3,(H,14,15)(H,16,19) |
| InChIKey | IDNWOEWYSPWDMQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |