C13H18ClN5O2 — CID 9205834
4-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 9205834) has the molecular formula C13H18ClN5O2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 4-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9205834 |
| Molecular Formula | C13H18ClN5O2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-chloro-N-[2-[(4-methylpiperazin-1-yl)amino]-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | CN1CCN(NC(=O)CNC(=O)c2cc(Cl)ccn2)CC1 |
| InChI | InChI=1S/C13H18ClN5O2/c1-18-4-6-19(7-5-18)17-12(20)9-16-13(21)11-8-10(14)2-3-15-11/h2-3,8H,4-7,9H2,1H3,(H,16,21)(H,17,20) |
| InChIKey | HGSALXPVPPLSCR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |