C16H21N3O4S2 — CID 87925336
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]thieno[3,4-c]pyridine-6-carboxamide;methanesulfonic acid (PubChem CID 87925336) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]thieno[3,4-c]pyridine-6-carboxamide;methanesulfonic acid.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]thieno[3,4-c]pyridine-6-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 87925336 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]thieno[3,4-c]pyridine-6-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(N[C@H]1CN2CCC1CC2)c1cc2cscc2cn1 |
| InChI | InChI=1S/C15H17N3OS.CH4O3S/c19-15(13-5-11-8-20-9-12(11)6-16-13)17-14-7-18-3-1-10(14)2-4-18;1-5(2,3)4/h5-6,8-10,14H,1-4,7H2,(H,17,19);1H3,(H,2,3,4)/t14-;/m0./s1 |
| InChIKey | BCKKMCXDLFONPN-UQKRIMTDSA-N |
| XLogP | 1.62 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|