C12H17N5O — CID 62154374
6-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)pyridazine-3-carboxamide (PubChem CID 62154374) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)pyridazine-3-carboxamide.
| Compound Name | 6-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62154374 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 6-amino-N-(1-azabicyclo[2.2.2]octan-3-yl)pyridazine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)NC2CN3CCC2CC3)nn1 |
| InChI | InChI=1S/C12H17N5O/c13-11-2-1-9(15-16-11)12(18)14-10-7-17-5-3-8(10)4-6-17/h1-2,8,10H,3-7H2,(H2,13,16)(H,14,18) |
| InChIKey | WQGDEUYXSGKREX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |