C19H22IN3O4 — CID 118306931
methyl 4-[[3-hydroxy-1-[(3-iodophenyl)methyl]-2-oxo-4-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 118306931) has the molecular formula C19H22IN3O4 and a molecular weight of 483.31 g/mol. Its IUPAC name is methyl 4-[[3-hydroxy-1-[(3-iodophenyl)methyl]-2-oxo-4-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[[3-hydroxy-1-[(3-iodophenyl)methyl]-2-oxo-4-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118306931 |
| Molecular Formula | C19H22IN3O4 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | methyl 4-[[3-hydroxy-1-[(3-iodophenyl)methyl]-2-oxo-4-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(Cc2ccn(Cc3cccc(I)c3)c(=O)c2O)CC1 |
| InChI | InChI=1S/C19H22IN3O4/c1-27-19(26)22-9-7-21(8-10-22)13-15-5-6-23(18(25)17(15)24)12-14-3-2-4-16(20)11-14/h2-6,11,24H,7-10,12-13H2,1H3 |
| InChIKey | MLEBQFVPPAPTLO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|