C20H16F3N3O2 — CID 118307508
3-[3-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propanoic acid (PubChem CID 118307508) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 3-[3-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118307508 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-[3-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(-c2cccc(Nc3nccc(C(F)(F)F)n3)c2)c1 |
| InChI | InChI=1S/C20H16F3N3O2/c21-20(22,23)17-9-10-24-19(26-17)25-16-6-2-5-15(12-16)14-4-1-3-13(11-14)7-8-18(27)28/h1-6,9-12H,7-8H2,(H,27,28)(H,24,25,26) |
| InChIKey | YBFQMKZQEYYXSK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |