C17H23BrN2O3 — CID 118307716
propan-2-yl 2-[5-bromo-4-(3,3-dimethylazetidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate (PubChem CID 118307716) has the molecular formula C17H23BrN2O3 and a molecular weight of 383.29 g/mol. Its IUPAC name is propan-2-yl 2-[5-bromo-4-(3,3-dimethylazetidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate.
| Compound Name | propan-2-yl 2-[5-bromo-4-(3,3-dimethylazetidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate |
|---|---|
| PubChem CID | 118307716 |
| Molecular Formula | C17H23BrN2O3 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | propan-2-yl 2-[5-bromo-4-(3,3-dimethylazetidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate |
| SMILES | Cc1nc(C)c(C(=O)C(=O)OC(C)C)c(N2CC(C)(C)C2)c1Br |
| InChI | InChI=1S/C17H23BrN2O3/c1-9(2)23-16(22)15(21)12-10(3)19-11(4)13(18)14(12)20-7-17(5,6)8-20/h9H,7-8H2,1-6H3 |
| InChIKey | ZCNNPWDRUYFEOD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|