C18H24BrFN2O3 — CID 118307830
propan-2-yl 2-[5-bromo-4-(4-fluoro-4-methylpiperidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate (PubChem CID 118307830) has the molecular formula C18H24BrFN2O3 and a molecular weight of 415.30 g/mol. Its IUPAC name is propan-2-yl 2-[5-bromo-4-(4-fluoro-4-methylpiperidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate.
| Compound Name | propan-2-yl 2-[5-bromo-4-(4-fluoro-4-methylpiperidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate |
|---|---|
| PubChem CID | 118307830 |
| Molecular Formula | C18H24BrFN2O3 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | propan-2-yl 2-[5-bromo-4-(4-fluoro-4-methylpiperidin-1-yl)-2,6-dimethyl-3-pyridinyl]-2-oxoacetate |
| SMILES | Cc1nc(C)c(C(=O)C(=O)OC(C)C)c(N2CCC(C)(F)CC2)c1Br |
| InChI | InChI=1S/C18H24BrFN2O3/c1-10(2)25-17(24)16(23)13-11(3)21-12(4)14(19)15(13)22-8-6-18(5,20)7-9-22/h10H,6-9H2,1-5H3 |
| InChIKey | PKOCKBDQCXBXKJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|