C20H22F2O6 — CID 118309004
methyl 5,5-difluoro-2-(3-oxo-2-phenylmethoxycarbonylbutanoyl)cyclohexane-1-carboxylate (PubChem CID 118309004) has the molecular formula C20H22F2O6 and a molecular weight of 396.39 g/mol. Its IUPAC name is methyl 5,5-difluoro-2-(3-oxo-2-phenylmethoxycarbonylbutanoyl)cyclohexane-1-carboxylate.
| Compound Name | methyl 5,5-difluoro-2-(3-oxo-2-phenylmethoxycarbonylbutanoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118309004 |
| Molecular Formula | C20H22F2O6 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl 5,5-difluoro-2-(3-oxo-2-phenylmethoxycarbonylbutanoyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CC(F)(F)CCC1C(=O)C(C(C)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22F2O6/c1-12(23)16(19(26)28-11-13-6-4-3-5-7-13)17(24)14-8-9-20(21,22)10-15(14)18(25)27-2/h3-7,14-16H,8-11H2,1-2H3 |
| InChIKey | KEEWXZIFMGMSNE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|