C16H23F2NO — CID 118309422
(1-tert-butylpiperidin-4-yl)-(2,4-difluorophenyl)methanol (PubChem CID 118309422) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is (1-tert-butylpiperidin-4-yl)-(2,4-difluorophenyl)methanol.
| Compound Name | (1-tert-butylpiperidin-4-yl)-(2,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 118309422 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (1-tert-butylpiperidin-4-yl)-(2,4-difluorophenyl)methanol |
| SMILES | CC(C)(C)N1CCC(C(O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H23F2NO/c1-16(2,3)19-8-6-11(7-9-19)15(20)13-5-4-12(17)10-14(13)18/h4-5,10-11,15,20H,6-9H2,1-3H3 |
| InChIKey | BOYPTQOYXHHHEG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |