C16H25F2N — CID 143435632
1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane (PubChem CID 143435632) has the molecular formula C16H25F2N and a molecular weight of 269.38 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane.
| Compound Name | 1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane |
|---|---|
| PubChem CID | 143435632 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane |
| SMILES | CC.CC(C)(C)N1CCC(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H19F2N.C2H6/c1-14(2,3)17-7-6-10(9-17)12-5-4-11(15)8-13(12)16;1-2/h4-5,8,10H,6-7,9H2,1-3H3;1-2H3 |
| InChIKey | JCWWBKUYUVMACZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |