C30H40F3N3O2 — CID 142165833
(3R)-1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;N-[1-[5-fluoro-2-(1-formylpiperidin-4-yl)phenyl]ethyl]acetamide (PubChem CID 142165833) has the molecular formula C30H40F3N3O2 and a molecular weight of 531.66 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;N-[1-[5-fluoro-2-(1-formylpiperidin-4-yl)phenyl]ethyl]acetamide.
| Compound Name | (3R)-1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;N-[1-[5-fluoro-2-(1-formylpiperidin-4-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 142165833 |
| Molecular Formula | C30H40F3N3O2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (3R)-1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;N-[1-[5-fluoro-2-(1-formylpiperidin-4-yl)phenyl]ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1cc(F)ccc1C1CCN(C=O)CC1.CC(C)(C)N1CC[C@H](c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H21FN2O2.C14H19F2N/c1-11(18-12(2)21)16-9-14(17)3-4-15(16)13-5-7-19(10-20)8-6-13;1-14(2,3)17-7-6-10(9-17)12-5-4-11(15)8-13(12)16/h3-4,9-11,13H,5-8H2,1-2H3,(H,18,21);4-5,8,10H,6-7,9H2,1-3H3/t;10-/m.0/s1 |
| InChIKey | PDRMFVNPEHWLJW-CICJTZRQSA-N |
| XLogP | 5.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|