C17H27F2NO2 — CID 143435697
1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane;formic acid (PubChem CID 143435697) has the molecular formula C17H27F2NO2 and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane;formic acid.
| Compound Name | 1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane;formic acid |
|---|---|
| PubChem CID | 143435697 |
| Molecular Formula | C17H27F2NO2 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1-tert-butyl-3-(2,4-difluorophenyl)pyrrolidine;ethane;formic acid |
| SMILES | CC.CC(C)(C)N1CCC(c2ccc(F)cc2F)C1.O=CO |
| InChI | InChI=1S/C14H19F2N.C2H6.CH2O2/c1-14(2,3)17-7-6-10(9-17)12-5-4-11(15)8-13(12)16;1-2;2-1-3/h4-5,8,10H,6-7,9H2,1-3H3;1-2H3;1H,(H,2,3) |
| InChIKey | SZINXTRREADSAQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|